C16H17F9N2O2 — CID 175738913
5-(1,1,2,3,3,3-hexafluoropropyl)-2-(1,1,2-trifluoro-2-morpholin-4-ylethyl)-2,3,3a,4-tetrahydrofuro[3,2-b]pyridine (PubChem CID 175738913) has the molecular formula C16H17F9N2O2 and a molecular weight of 440.31 g/mol. Its IUPAC name is 5-(1,1,2,3,3,3-hexafluoropropyl)-2-(1,1,2-trifluoro-2-morpholin-4-ylethyl)-2,3,3a,4-tetrahydrofuro[3,2-b]pyridine.
| Compound Name | 5-(1,1,2,3,3,3-hexafluoropropyl)-2-(1,1,2-trifluoro-2-morpholin-4-ylethyl)-2,3,3a,4-tetrahydrofuro[3,2-b]pyridine |
|---|---|
| PubChem CID | 175738913 |
| Molecular Formula | C16H17F9N2O2 |
| Molecular Weight | 440.31 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | 5-(1,1,2,3,3,3-hexafluoropropyl)-2-(1,1,2-trifluoro-2-morpholin-4-ylethyl)-2,3,3a,4-tetrahydrofuro[3,2-b]pyridine |
| SMILES | FC(C(F)(F)F)C(F)(F)C1=CC=C2OC(C(F)(F)C(F)N3CCOCC3)CC2N1 |
| InChI | InChI=1S/C16H17F9N2O2/c17-12(16(23,24)25)14(19,20)10-2-1-9-8(26-10)7-11(29-9)15(21,22)13(18)27-3-5-28-6-4-27/h1-2,8,11-13,26H,3-7H2 |
| InChIKey | VCMOFRWHWCFTMY-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.31 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|