C11H19F3N2O — CID 171288800
1-[(1R)-2,2,2-trifluoro-1-(oxan-4-yl)ethyl]piperazine (PubChem CID 171288800) has the molecular formula C11H19F3N2O and a molecular weight of 252.28 g/mol. Its IUPAC name is 1-[(1R)-2,2,2-trifluoro-1-(oxan-4-yl)ethyl]piperazine.
| Compound Name | 1-[(1R)-2,2,2-trifluoro-1-(oxan-4-yl)ethyl]piperazine |
|---|---|
| PubChem CID | 171288800 |
| Molecular Formula | C11H19F3N2O |
| Molecular Weight | 252.28 g/mol |
| Exact Mass | 252.14 |
| IUPAC Name | 1-[(1R)-2,2,2-trifluoro-1-(oxan-4-yl)ethyl]piperazine |
| SMILES | FC(F)(F)[C@@H](C1CCOCC1)N1CCNCC1 |
| InChI | InChI=1S/C11H19F3N2O/c12-11(13,14)10(9-1-7-17-8-2-9)16-5-3-15-4-6-16/h9-10,15H,1-8H2/t10-/m1/s1 |
| InChIKey | JMIDGJRWNADYTL-SNVBAGLBSA-N |
| XLogP | 1.25 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.28 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |