C17H23F3N2O2 — CID 171280476
1-[(S)-oxan-4-yl-[2-(trifluoromethoxy)phenyl]methyl]piperazine (PubChem CID 171280476) has the molecular formula C17H23F3N2O2 and a molecular weight of 344.38 g/mol. Its IUPAC name is 1-[(S)-oxan-4-yl-[2-(trifluoromethoxy)phenyl]methyl]piperazine.
| Compound Name | 1-[(S)-oxan-4-yl-[2-(trifluoromethoxy)phenyl]methyl]piperazine |
|---|---|
| PubChem CID | 171280476 |
| Molecular Formula | C17H23F3N2O2 |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.17 |
| IUPAC Name | 1-[(S)-oxan-4-yl-[2-(trifluoromethoxy)phenyl]methyl]piperazine |
| SMILES | FC(F)(F)Oc1ccccc1[C@H](C1CCOCC1)N1CCNCC1 |
| InChI | InChI=1S/C17H23F3N2O2/c18-17(19,20)24-15-4-2-1-3-14(15)16(13-5-11-23-12-6-13)22-9-7-21-8-10-22/h1-4,13,16,21H,5-12H2/t16-/m0/s1 |
| InChIKey | FXKRQXUKINRAES-INIZCTEOSA-N |
| XLogP | 2.96 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |