About [3,5-dichloro-4-[morpholin-4-yl-(2-oxopyrrolidin-3-yl)methyl]phenyl] trifluoromethanesulfonate
[3,5-dichloro-4-[morpholin-4-yl-(2-oxopyrrolidin-3-yl)methyl]phenyl] trifluoromethanesulfonate (PubChem CID 87198342) has the molecular formula C16H17Cl2F3N2O5S
and a molecular weight of 477.29 g/mol. Its IUPAC name is [3,5-dichloro-4-[morpholin-4-yl-(2-oxopyrrolidin-3-yl)methyl]phenyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [3,5-dichloro-4-[morpholin-4-yl-(2-oxopyrrolidin-3-yl)methyl]phenyl] trifluoromethanesulfonate |
| PubChem CID | 87198342 |
| Molecular Formula | C16H17Cl2F3N2O5S |
| Molecular Weight | 477.29 g/mol |
| Exact Mass | 476.02 |
| IUPAC Name | [3,5-dichloro-4-[morpholin-4-yl-(2-oxopyrrolidin-3-yl)methyl]phenyl] trifluoromethanesulfonate |
| SMILES | O=C1NCCC1C(c1c(Cl)cc(OS(=O)(=O)C(F)(F)F)cc1Cl)N1CCOCC1 |
| InChI | InChI=1S/C16H17Cl2F3N2O5S/c17-11-7-9(28-29(25,26)16(19,20)21)8-12(18)13(11)14(10-1-2-22-15(10)24)23-3-5-27-6-4-23/h7-8,10,14H,1-6H2,(H,22,24) |
| InChIKey | NRTUDQPGXLXOQE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 477.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [3,5-dichloro-4-[morpholin-4-yl-(2-oxopyrrolidin-3-yl)methyl]phenyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,5-dichloro-4-[morpholin-4-yl-(2-oxopyrrolidin-3-yl)methyl]phenyl] trifluoromethanesulfonate?
The IUPAC name of [3,5-dichloro-4-[morpholin-4-yl-(2-oxopyrrolidin-3-yl)methyl]phenyl] trifluoromethanesulfonate (CID 87198342) is [3,5-dichloro-4-[morpholin-4-yl-(2-oxopyrrolidin-3-yl)methyl]phenyl] trifluoromethanesulfonate.
What is the SMILES notation for [3,5-dichloro-4-[morpholin-4-yl-(2-oxopyrrolidin-3-yl)methyl]phenyl] trifluoromethanesulfonate?
The canonical SMILES for [3,5-dichloro-4-[morpholin-4-yl-(2-oxopyrrolidin-3-yl)methyl]phenyl] trifluoromethanesulfonate is O=C1NCCC1C(c1c(Cl)cc(OS(=O)(=O)C(F)(F)F)cc1Cl)N1CCOCC1.
What is the InChIKey of [3,5-dichloro-4-[morpholin-4-yl-(2-oxopyrrolidin-3-yl)methyl]phenyl] trifluoromethanesulfonate?
The InChIKey is NRTUDQPGXLXOQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17Cl2F3N2O5S/c17-11-7-9(28-29(25,26)16(19,20)21)8-12(18)13(11)14(10-1-2-22-15(10)24)23-3-5-27-6-4-23/h7-8,10,14H,1-6H2,(H,22,24).
What are the key properties of [3,5-dichloro-4-[morpholin-4-yl-(2-oxopyrrolidin-3-yl)methyl]phenyl] trifluoromethanesulfonate?
[3,5-dichloro-4-[morpholin-4-yl-(2-oxopyrrolidin-3-yl)methyl]phenyl] trifluoromethanesulfonate has a molecular weight of 477.29 g/mol, XLogP of 2.73, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3,5-dichloro-4-[morpholin-4-yl-(2-oxopyrrolidin-3-yl)methyl]phenyl] trifluoromethanesulfonate is sourced from PubChem (CID 87198342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).