C16H17Cl2F3N2O5S — CID 87198342
[3,5-dichloro-4-[morpholin-4-yl-(2-oxopyrrolidin-3-yl)methyl]phenyl] trifluoromethanesulfonate (PubChem CID 87198342) has the molecular formula C16H17Cl2F3N2O5S and a molecular weight of 477.29 g/mol. Its IUPAC name is [3,5-dichloro-4-[morpholin-4-yl-(2-oxopyrrolidin-3-yl)methyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [3,5-dichloro-4-[morpholin-4-yl-(2-oxopyrrolidin-3-yl)methyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87198342 |
| Molecular Formula | C16H17Cl2F3N2O5S |
| Molecular Weight | 477.29 g/mol |
| Exact Mass | 476.02 |
| IUPAC Name | [3,5-dichloro-4-[morpholin-4-yl-(2-oxopyrrolidin-3-yl)methyl]phenyl] trifluoromethanesulfonate |
| SMILES | O=C1NCCC1C(c1c(Cl)cc(OS(=O)(=O)C(F)(F)F)cc1Cl)N1CCOCC1 |
| InChI | InChI=1S/C16H17Cl2F3N2O5S/c17-11-7-9(28-29(25,26)16(19,20)21)8-12(18)13(11)14(10-1-2-22-15(10)24)23-3-5-27-6-4-23/h7-8,10,14H,1-6H2,(H,22,24) |
| InChIKey | NRTUDQPGXLXOQE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|