C17H19Cl2F3N2O5S — CID 87198343
[3,5-dichloro-4-[(4-hydroxypiperidin-1-yl)-(2-oxopyrrolidin-3-yl)methyl]phenyl] trifluoromethanesulfonate (PubChem CID 87198343) has the molecular formula C17H19Cl2F3N2O5S and a molecular weight of 491.32 g/mol. Its IUPAC name is [3,5-dichloro-4-[(4-hydroxypiperidin-1-yl)-(2-oxopyrrolidin-3-yl)methyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [3,5-dichloro-4-[(4-hydroxypiperidin-1-yl)-(2-oxopyrrolidin-3-yl)methyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87198343 |
| Molecular Formula | C17H19Cl2F3N2O5S |
| Molecular Weight | 491.32 g/mol |
| Exact Mass | 490.03 |
| IUPAC Name | [3,5-dichloro-4-[(4-hydroxypiperidin-1-yl)-(2-oxopyrrolidin-3-yl)methyl]phenyl] trifluoromethanesulfonate |
| SMILES | O=C1NCCC1C(c1c(Cl)cc(OS(=O)(=O)C(F)(F)F)cc1Cl)N1CCC(O)CC1 |
| InChI | InChI=1S/C17H19Cl2F3N2O5S/c18-12-7-10(29-30(27,28)17(20,21)22)8-13(19)14(12)15(11-1-4-23-16(11)26)24-5-2-9(25)3-6-24/h7-9,11,15,25H,1-6H2,(H,23,26) |
| InChIKey | AMFROLUNMVFTED-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|