C17H19Cl2F3N2O4S — CID 87330700
[3,5-dichloro-4-[[(3R)-2-oxo-1-piperidin-1-ylpyrrolidin-3-yl]methyl]phenyl] trifluoromethanesulfonate (PubChem CID 87330700) has the molecular formula C17H19Cl2F3N2O4S and a molecular weight of 475.32 g/mol. Its IUPAC name is [3,5-dichloro-4-[[(3R)-2-oxo-1-piperidin-1-ylpyrrolidin-3-yl]methyl]phenyl] trifluoromethanesulfonate.
| Compound Name | [3,5-dichloro-4-[[(3R)-2-oxo-1-piperidin-1-ylpyrrolidin-3-yl]methyl]phenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87330700 |
| Molecular Formula | C17H19Cl2F3N2O4S |
| Molecular Weight | 475.32 g/mol |
| Exact Mass | 474.04 |
| IUPAC Name | [3,5-dichloro-4-[[(3R)-2-oxo-1-piperidin-1-ylpyrrolidin-3-yl]methyl]phenyl] trifluoromethanesulfonate |
| SMILES | O=C1[C@H](Cc2c(Cl)cc(OS(=O)(=O)C(F)(F)F)cc2Cl)CCN1N1CCCCC1 |
| InChI | InChI=1S/C17H19Cl2F3N2O4S/c18-14-9-12(28-29(26,27)17(20,21)22)10-15(19)13(14)8-11-4-7-24(16(11)25)23-5-2-1-3-6-23/h9-11H,1-8H2/t11-/m0/s1 |
| InChIKey | FRJRIOPQKBPUBT-NSHDSACASA-N |
| XLogP | 4.01 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.32 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|