C16H17ClF3NO3S — CID 22390416
[4-[3-(azepan-1-yl)prop-1-ynyl]-3-chlorophenyl] trifluoromethanesulfonate (PubChem CID 22390416) has the molecular formula C16H17ClF3NO3S and a molecular weight of 395.83 g/mol. Its IUPAC name is [4-[3-(azepan-1-yl)prop-1-ynyl]-3-chlorophenyl] trifluoromethanesulfonate.
| Compound Name | [4-[3-(azepan-1-yl)prop-1-ynyl]-3-chlorophenyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 22390416 |
| Molecular Formula | C16H17ClF3NO3S |
| Molecular Weight | 395.83 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | [4-[3-(azepan-1-yl)prop-1-ynyl]-3-chlorophenyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc(C#CCN2CCCCCC2)c(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C16H17ClF3NO3S/c17-15-12-14(24-25(22,23)16(18,19)20)8-7-13(15)6-5-11-21-9-3-1-2-4-10-21/h7-8,12H,1-4,9-11H2 |
| InChIKey | FHNBIMHIPIXZHW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.83 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|