C18H26ClF3N2O4S — CID 87084293
[4-[(2R)-1-oxo-1-(3-piperidin-1-ylpropylamino)propan-2-yl]phenyl] trifluoromethanesulfonate;hydrochloride (PubChem CID 87084293) has the molecular formula C18H26ClF3N2O4S and a molecular weight of 458.93 g/mol. Its IUPAC name is [4-[(2R)-1-oxo-1-(3-piperidin-1-ylpropylamino)propan-2-yl]phenyl] trifluoromethanesulfonate;hydrochloride.
| Compound Name | [4-[(2R)-1-oxo-1-(3-piperidin-1-ylpropylamino)propan-2-yl]phenyl] trifluoromethanesulfonate;hydrochloride |
|---|---|
| PubChem CID | 87084293 |
| Molecular Formula | C18H26ClF3N2O4S |
| Molecular Weight | 458.93 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | [4-[(2R)-1-oxo-1-(3-piperidin-1-ylpropylamino)propan-2-yl]phenyl] trifluoromethanesulfonate;hydrochloride |
| SMILES | C[C@@H](C(=O)NCCCN1CCCCC1)c1ccc(OS(=O)(=O)C(F)(F)F)cc1.Cl |
| InChI | InChI=1S/C18H25F3N2O4S.ClH/c1-14(17(24)22-10-5-13-23-11-3-2-4-12-23)15-6-8-16(9-7-15)27-28(25,26)18(19,20)21;/h6-9,14H,2-5,10-13H2,1H3,(H,22,24);1H/t14-;/m1./s1 |
| InChIKey | XBXBNPDHWNYSSP-PFEQFJNWSA-N |
| XLogP | 3.43 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.93 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|