C16H22ClF3N2O4S — CID 87084546
[4-[(2R)-1-oxo-1-(2-pyrrolidin-1-ylethylamino)propan-2-yl]phenyl] trifluoromethanesulfonate;hydrochloride (PubChem CID 87084546) has the molecular formula C16H22ClF3N2O4S and a molecular weight of 430.88 g/mol. Its IUPAC name is [4-[(2R)-1-oxo-1-(2-pyrrolidin-1-ylethylamino)propan-2-yl]phenyl] trifluoromethanesulfonate;hydrochloride.
| Compound Name | [4-[(2R)-1-oxo-1-(2-pyrrolidin-1-ylethylamino)propan-2-yl]phenyl] trifluoromethanesulfonate;hydrochloride |
|---|---|
| PubChem CID | 87084546 |
| Molecular Formula | C16H22ClF3N2O4S |
| Molecular Weight | 430.88 g/mol |
| Exact Mass | 430.09 |
| IUPAC Name | [4-[(2R)-1-oxo-1-(2-pyrrolidin-1-ylethylamino)propan-2-yl]phenyl] trifluoromethanesulfonate;hydrochloride |
| SMILES | C[C@@H](C(=O)NCCN1CCCC1)c1ccc(OS(=O)(=O)C(F)(F)F)cc1.Cl |
| InChI | InChI=1S/C16H21F3N2O4S.ClH/c1-12(15(22)20-8-11-21-9-2-3-10-21)13-4-6-14(7-5-13)25-26(23,24)16(17,18)19;/h4-7,12H,2-3,8-11H2,1H3,(H,20,22);1H/t12-;/m1./s1 |
| InChIKey | IIYLBLWDULWOKP-UTONKHPSSA-N |
| XLogP | 2.65 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.88 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|