C32H46Cl2N2O4SSi — CID 66905071
3-[[2,6-dichloro-4-(4-methylsulfonylphenyl)phenyl]methyl]-1-[4-tri(propan-2-yl)silyloxypiperidin-1-yl]pyrrolidin-2-one (PubChem CID 66905071) has the molecular formula C32H46Cl2N2O4SSi and a molecular weight of 653.79 g/mol. Its IUPAC name is 3-[[2,6-dichloro-4-(4-methylsulfonylphenyl)phenyl]methyl]-1-[4-tri(propan-2-yl)silyloxypiperidin-1-yl]pyrrolidin-2-one.
| Compound Name | 3-[[2,6-dichloro-4-(4-methylsulfonylphenyl)phenyl]methyl]-1-[4-tri(propan-2-yl)silyloxypiperidin-1-yl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 66905071 |
| Molecular Formula | C32H46Cl2N2O4SSi |
| Molecular Weight | 653.79 g/mol |
| Exact Mass | 652.23 |
| IUPAC Name | 3-[[2,6-dichloro-4-(4-methylsulfonylphenyl)phenyl]methyl]-1-[4-tri(propan-2-yl)silyloxypiperidin-1-yl]pyrrolidin-2-one |
| SMILES | CC(C)[Si](OC1CCN(N2CCC(Cc3c(Cl)cc(-c4ccc(S(C)(=O)=O)cc4)cc3Cl)C2=O)CC1)(C(C)C)C(C)C |
| InChI | InChI=1S/C32H46Cl2N2O4SSi/c1-21(2)42(22(3)4,23(5)6)40-27-13-15-35(16-14-27)36-17-12-25(32(36)37)18-29-30(33)19-26(20-31(29)34)24-8-10-28(11-9-24)41(7,38)39/h8-11,19-23,25,27H,12-18H2,1-7H3 |
| InChIKey | NUTHAHKVTNWLJU-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.79 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|