About ethyl 2-[4-[3,5-dichloro-4-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]phenyl]phenoxy]acetate
ethyl 2-[4-[3,5-dichloro-4-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]phenyl]phenoxy]acetate (PubChem CID 11569665) has the molecular formula C27H31Cl2NO4
and a molecular weight of 504.45 g/mol. Its IUPAC name is ethyl 2-[4-[3,5-dichloro-4-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]phenyl]phenoxy]acetate.
Molecular Properties
| Compound Name | ethyl 2-[4-[3,5-dichloro-4-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]phenyl]phenoxy]acetate |
| PubChem CID | 11569665 |
| Molecular Formula | C27H31Cl2NO4 |
| Molecular Weight | 504.45 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | ethyl 2-[4-[3,5-dichloro-4-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]phenyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(-c2cc(Cl)c(CC3CCN(C4CCCCC4)C3=O)c(Cl)c2)cc1 |
| InChI | InChI=1S/C27H31Cl2NO4/c1-2-33-26(31)17-34-22-10-8-18(9-11-22)20-15-24(28)23(25(29)16-20)14-19-12-13-30(27(19)32)21-6-4-3-5-7-21/h8-11,15-16,19,21H,2-7,12-14,17H2,1H3 |
| InChIKey | RQDWAWXHYCIGKH-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 504.45 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-[4-[3,5-dichloro-4-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]phenyl]phenoxy]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[4-[3,5-dichloro-4-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]phenyl]phenoxy]acetate?
The IUPAC name of ethyl 2-[4-[3,5-dichloro-4-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]phenyl]phenoxy]acetate (CID 11569665) is ethyl 2-[4-[3,5-dichloro-4-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]phenyl]phenoxy]acetate.
What is the SMILES notation for ethyl 2-[4-[3,5-dichloro-4-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]phenyl]phenoxy]acetate?
The canonical SMILES for ethyl 2-[4-[3,5-dichloro-4-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]phenyl]phenoxy]acetate is CCOC(=O)COc1ccc(-c2cc(Cl)c(CC3CCN(C4CCCCC4)C3=O)c(Cl)c2)cc1.
What is the InChIKey of ethyl 2-[4-[3,5-dichloro-4-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]phenyl]phenoxy]acetate?
The InChIKey is RQDWAWXHYCIGKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H31Cl2NO4/c1-2-33-26(31)17-34-22-10-8-18(9-11-22)20-15-24(28)23(25(29)16-20)14-19-12-13-30(27(19)32)21-6-4-3-5-7-21/h8-11,15-16,19,21H,2-7,12-14,17H2,1H3.
What are the key properties of ethyl 2-[4-[3,5-dichloro-4-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]phenyl]phenoxy]acetate?
ethyl 2-[4-[3,5-dichloro-4-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]phenyl]phenoxy]acetate has a molecular weight of 504.45 g/mol, XLogP of 6.33, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[4-[3,5-dichloro-4-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]phenyl]phenoxy]acetate is sourced from PubChem (CID 11569665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).