C23H31ClFNO3 — CID 59299438
ethyl 4-[4-chloro-3-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]-2-fluorophenyl]butanoate (PubChem CID 59299438) has the molecular formula C23H31ClFNO3 and a molecular weight of 423.96 g/mol. Its IUPAC name is ethyl 4-[4-chloro-3-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]-2-fluorophenyl]butanoate.
| Compound Name | ethyl 4-[4-chloro-3-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]-2-fluorophenyl]butanoate |
|---|---|
| PubChem CID | 59299438 |
| Molecular Formula | C23H31ClFNO3 |
| Molecular Weight | 423.96 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | ethyl 4-[4-chloro-3-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]-2-fluorophenyl]butanoate |
| SMILES | CCOC(=O)CCCc1ccc(Cl)c(CC2CCN(C3CCCCC3)C2=O)c1F |
| InChI | InChI=1S/C23H31ClFNO3/c1-2-29-21(27)10-6-7-16-11-12-20(24)19(22(16)25)15-17-13-14-26(23(17)28)18-8-4-3-5-9-18/h11-12,17-18H,2-10,13-15H2,1H3 |
| InChIKey | QEMSRQNQXFHWIW-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.96 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |