C28H34ClNO3 — CID 59299462
tert-butyl 3-[3-chloro-4-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]phenyl]benzoate (PubChem CID 59299462) has the molecular formula C28H34ClNO3 and a molecular weight of 468.04 g/mol. Its IUPAC name is tert-butyl 3-[3-chloro-4-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]phenyl]benzoate.
| Compound Name | tert-butyl 3-[3-chloro-4-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 59299462 |
| Molecular Formula | C28H34ClNO3 |
| Molecular Weight | 468.04 g/mol |
| Exact Mass | 467.22 |
| IUPAC Name | tert-butyl 3-[3-chloro-4-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]phenyl]benzoate |
| SMILES | CC(C)(C)OC(=O)c1cccc(-c2ccc(CC3CCN(C4CCCCC4)C3=O)c(Cl)c2)c1 |
| InChI | InChI=1S/C28H34ClNO3/c1-28(2,3)33-27(32)23-9-7-8-19(16-23)20-12-13-21(25(29)18-20)17-22-14-15-30(26(22)31)24-10-5-4-6-11-24/h7-9,12-13,16,18,22,24H,4-6,10-11,14-15,17H2,1-3H3 |
| InChIKey | SETBEVUMNRMULF-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.04 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |