About 1-cyclohexyl-3-[[2,6-dichloro-4-(4-methylphenyl)phenyl]methyl]pyrrolidin-2-one
1-cyclohexyl-3-[[2,6-dichloro-4-(4-methylphenyl)phenyl]methyl]pyrrolidin-2-one (PubChem CID 143568177) has the molecular formula C24H27Cl2NO
and a molecular weight of 416.39 g/mol. Its IUPAC name is 1-cyclohexyl-3-[[2,6-dichloro-4-(4-methylphenyl)phenyl]methyl]pyrrolidin-2-one.
Molecular Properties
| Compound Name | 1-cyclohexyl-3-[[2,6-dichloro-4-(4-methylphenyl)phenyl]methyl]pyrrolidin-2-one |
| PubChem CID | 143568177 |
| Molecular Formula | C24H27Cl2NO |
| Molecular Weight | 416.39 g/mol |
| Exact Mass | 415.15 |
| IUPAC Name | 1-cyclohexyl-3-[[2,6-dichloro-4-(4-methylphenyl)phenyl]methyl]pyrrolidin-2-one |
| SMILES | Cc1ccc(-c2cc(Cl)c(CC3CCN(C4CCCCC4)C3=O)c(Cl)c2)cc1 |
| InChI | InChI=1S/C24H27Cl2NO/c1-16-7-9-17(10-8-16)19-14-22(25)21(23(26)15-19)13-18-11-12-27(24(18)28)20-5-3-2-4-6-20/h7-10,14-15,18,20H,2-6,11-13H2,1H3 |
| InChIKey | LFSRXVVHEQOFOL-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.39 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-cyclohexyl-3-[[2,6-dichloro-4-(4-methylphenyl)phenyl]methyl]pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexyl-3-[[2,6-dichloro-4-(4-methylphenyl)phenyl]methyl]pyrrolidin-2-one?
The IUPAC name of 1-cyclohexyl-3-[[2,6-dichloro-4-(4-methylphenyl)phenyl]methyl]pyrrolidin-2-one (CID 143568177) is 1-cyclohexyl-3-[[2,6-dichloro-4-(4-methylphenyl)phenyl]methyl]pyrrolidin-2-one.
What is the SMILES notation for 1-cyclohexyl-3-[[2,6-dichloro-4-(4-methylphenyl)phenyl]methyl]pyrrolidin-2-one?
The canonical SMILES for 1-cyclohexyl-3-[[2,6-dichloro-4-(4-methylphenyl)phenyl]methyl]pyrrolidin-2-one is Cc1ccc(-c2cc(Cl)c(CC3CCN(C4CCCCC4)C3=O)c(Cl)c2)cc1.
What is the InChIKey of 1-cyclohexyl-3-[[2,6-dichloro-4-(4-methylphenyl)phenyl]methyl]pyrrolidin-2-one?
The InChIKey is LFSRXVVHEQOFOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27Cl2NO/c1-16-7-9-17(10-8-16)19-14-22(25)21(23(26)15-19)13-18-11-12-27(24(18)28)20-5-3-2-4-6-20/h7-10,14-15,18,20H,2-6,11-13H2,1H3.
What are the key properties of 1-cyclohexyl-3-[[2,6-dichloro-4-(4-methylphenyl)phenyl]methyl]pyrrolidin-2-one?
1-cyclohexyl-3-[[2,6-dichloro-4-(4-methylphenyl)phenyl]methyl]pyrrolidin-2-one has a molecular weight of 416.39 g/mol, XLogP of 6.69, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexyl-3-[[2,6-dichloro-4-(4-methylphenyl)phenyl]methyl]pyrrolidin-2-one is sourced from PubChem (CID 143568177), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).