C34H43Cl2N3O4 — CID 67522818
butyl N-[1-[4-[3,5-dichloro-4-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]phenyl]benzoyl]piperidin-4-yl]carbamate (PubChem CID 67522818) has the molecular formula C34H43Cl2N3O4 and a molecular weight of 628.64 g/mol. Its IUPAC name is butyl N-[1-[4-[3,5-dichloro-4-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]phenyl]benzoyl]piperidin-4-yl]carbamate.
| Compound Name | butyl N-[1-[4-[3,5-dichloro-4-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]phenyl]benzoyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 67522818 |
| Molecular Formula | C34H43Cl2N3O4 |
| Molecular Weight | 628.64 g/mol |
| Exact Mass | 627.26 |
| IUPAC Name | butyl N-[1-[4-[3,5-dichloro-4-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]phenyl]benzoyl]piperidin-4-yl]carbamate |
| SMILES | CCCCOC(=O)NC1CCN(C(=O)c2ccc(-c3cc(Cl)c(CC4CCN(C5CCCCC5)C4=O)c(Cl)c3)cc2)CC1 |
| InChI | InChI=1S/C34H43Cl2N3O4/c1-2-3-19-43-34(42)37-27-14-16-38(17-15-27)32(40)24-11-9-23(10-12-24)26-21-30(35)29(31(36)22-26)20-25-13-18-39(33(25)41)28-7-5-4-6-8-28/h9-12,21-22,25,27-28H,2-8,13-20H2,1H3,(H,37,42) |
| InChIKey | AWOMZDORXRZIBV-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.64 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|