C17H23FN2O3 — CID 108563672
butyl N-[1-(4-fluorobenzoyl)piperidin-4-yl]carbamate (PubChem CID 108563672) has the molecular formula C17H23FN2O3 and a molecular weight of 322.38 g/mol. Its IUPAC name is butyl N-[1-(4-fluorobenzoyl)piperidin-4-yl]carbamate.
| Compound Name | butyl N-[1-(4-fluorobenzoyl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 108563672 |
| Molecular Formula | C17H23FN2O3 |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | butyl N-[1-(4-fluorobenzoyl)piperidin-4-yl]carbamate |
| SMILES | CCCCOC(=O)NC1CCN(C(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C17H23FN2O3/c1-2-3-12-23-17(22)19-15-8-10-20(11-9-15)16(21)13-4-6-14(18)7-5-13/h4-7,15H,2-3,8-12H2,1H3,(H,19,22) |
| InChIKey | ARIZDIIZFBRSSK-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|