C20H28N2O6 — CID 108563373
ethyl [4-[4-(2-methylpropoxycarbonylamino)piperidine-1-carbonyl]phenyl] carbonate (PubChem CID 108563373) has the molecular formula C20H28N2O6 and a molecular weight of 392.45 g/mol. Its IUPAC name is ethyl [4-[4-(2-methylpropoxycarbonylamino)piperidine-1-carbonyl]phenyl] carbonate.
| Compound Name | ethyl [4-[4-(2-methylpropoxycarbonylamino)piperidine-1-carbonyl]phenyl] carbonate |
|---|---|
| PubChem CID | 108563373 |
| Molecular Formula | C20H28N2O6 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | ethyl [4-[4-(2-methylpropoxycarbonylamino)piperidine-1-carbonyl]phenyl] carbonate |
| SMILES | CCOC(=O)Oc1ccc(C(=O)N2CCC(NC(=O)OCC(C)C)CC2)cc1 |
| InChI | InChI=1S/C20H28N2O6/c1-4-26-20(25)28-17-7-5-15(6-8-17)18(23)22-11-9-16(10-12-22)21-19(24)27-13-14(2)3/h5-8,14,16H,4,9-13H2,1-3H3,(H,21,24) |
| InChIKey | DJSWMGOJDXTJOX-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|