C33H41Cl2N3O4 — CID 67522807
butyl 4-[4-[3,5-dichloro-4-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]phenyl]benzoyl]piperazine-1-carboxylate (PubChem CID 67522807) has the molecular formula C33H41Cl2N3O4 and a molecular weight of 614.61 g/mol. Its IUPAC name is butyl 4-[4-[3,5-dichloro-4-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]phenyl]benzoyl]piperazine-1-carboxylate.
| Compound Name | butyl 4-[4-[3,5-dichloro-4-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]phenyl]benzoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 67522807 |
| Molecular Formula | C33H41Cl2N3O4 |
| Molecular Weight | 614.61 g/mol |
| Exact Mass | 613.25 |
| IUPAC Name | butyl 4-[4-[3,5-dichloro-4-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]phenyl]benzoyl]piperazine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCN(C(=O)c2ccc(-c3cc(Cl)c(CC4CCN(C5CCCCC5)C4=O)c(Cl)c3)cc2)CC1 |
| InChI | InChI=1S/C33H41Cl2N3O4/c1-2-3-19-42-33(41)37-17-15-36(16-18-37)31(39)24-11-9-23(10-12-24)26-21-29(34)28(30(35)22-26)20-25-13-14-38(32(25)40)27-7-5-4-6-8-27/h9-12,21-22,25,27H,2-8,13-20H2,1H3 |
| InChIKey | WUHPFZUFRVQNJT-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.61 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|