C20H26ClNO3 — CID 87681590
3-[[2-(3-chloro-2-oxopropoxy)phenyl]methyl]-1-cyclohexylpyrrolidin-2-one (PubChem CID 87681590) has the molecular formula C20H26ClNO3 and a molecular weight of 363.89 g/mol. Its IUPAC name is 3-[[2-(3-chloro-2-oxopropoxy)phenyl]methyl]-1-cyclohexylpyrrolidin-2-one.
| Compound Name | 3-[[2-(3-chloro-2-oxopropoxy)phenyl]methyl]-1-cyclohexylpyrrolidin-2-one |
|---|---|
| PubChem CID | 87681590 |
| Molecular Formula | C20H26ClNO3 |
| Molecular Weight | 363.89 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 3-[[2-(3-chloro-2-oxopropoxy)phenyl]methyl]-1-cyclohexylpyrrolidin-2-one |
| SMILES | O=C(CCl)COc1ccccc1CC1CCN(C2CCCCC2)C1=O |
| InChI | InChI=1S/C20H26ClNO3/c21-13-18(23)14-25-19-9-5-4-6-15(19)12-16-10-11-22(20(16)24)17-7-2-1-3-8-17/h4-6,9,16-17H,1-3,7-8,10-14H2 |
| InChIKey | LEEDBZBLOOLJHK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.89 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|