C25H29ClN2O2 — CID 163623846
N-benzyl-3-chloro-4-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]benzamide (PubChem CID 163623846) has the molecular formula C25H29ClN2O2 and a molecular weight of 424.97 g/mol. Its IUPAC name is N-benzyl-3-chloro-4-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]benzamide.
| Compound Name | N-benzyl-3-chloro-4-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 163623846 |
| Molecular Formula | C25H29ClN2O2 |
| Molecular Weight | 424.97 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | N-benzyl-3-chloro-4-[(1-cyclohexyl-2-oxopyrrolidin-3-yl)methyl]benzamide |
| SMILES | O=C(NCc1ccccc1)c1ccc(CC2CCN(C3CCCCC3)C2=O)c(Cl)c1 |
| InChI | InChI=1S/C25H29ClN2O2/c26-23-16-20(24(29)27-17-18-7-3-1-4-8-18)12-11-19(23)15-21-13-14-28(25(21)30)22-9-5-2-6-10-22/h1,3-4,7-8,11-12,16,21-22H,2,5-6,9-10,13-15,17H2,(H,27,29) |
| InChIKey | HQKHDOOFVQCEMS-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.97 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |