C21H31NO3 — CID 173174596
1-cyclooctyl-3-[(3,5-dimethoxyphenyl)methyl]pyrrolidin-2-one (PubChem CID 173174596) has the molecular formula C21H31NO3 and a molecular weight of 345.48 g/mol. Its IUPAC name is 1-cyclooctyl-3-[(3,5-dimethoxyphenyl)methyl]pyrrolidin-2-one.
| Compound Name | 1-cyclooctyl-3-[(3,5-dimethoxyphenyl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 173174596 |
| Molecular Formula | C21H31NO3 |
| Molecular Weight | 345.48 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | 1-cyclooctyl-3-[(3,5-dimethoxyphenyl)methyl]pyrrolidin-2-one |
| SMILES | COc1cc(CC2CCN(C3CCCCCCC3)C2=O)cc(OC)c1 |
| InChI | InChI=1S/C21H31NO3/c1-24-19-13-16(14-20(15-19)25-2)12-17-10-11-22(21(17)23)18-8-6-4-3-5-7-9-18/h13-15,17-18H,3-12H2,1-2H3 |
| InChIKey | NIUMIUVCEFBTKP-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.48 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |