C17H18ClF3N2O6S — CID 87541126
tert-butyl (10bR)-7-chloro-6-oxo-9-(trifluoromethylsulfonyloxy)-1,3,4,10b-tetrahydropyrazino[2,1-a]isoindole-2-carboxylate (PubChem CID 87541126) has the molecular formula C17H18ClF3N2O6S and a molecular weight of 470.85 g/mol. Its IUPAC name is tert-butyl (10bR)-7-chloro-6-oxo-9-(trifluoromethylsulfonyloxy)-1,3,4,10b-tetrahydropyrazino[2,1-a]isoindole-2-carboxylate.
| Compound Name | tert-butyl (10bR)-7-chloro-6-oxo-9-(trifluoromethylsulfonyloxy)-1,3,4,10b-tetrahydropyrazino[2,1-a]isoindole-2-carboxylate |
|---|---|
| PubChem CID | 87541126 |
| Molecular Formula | C17H18ClF3N2O6S |
| Molecular Weight | 470.85 g/mol |
| Exact Mass | 470.05 |
| IUPAC Name | tert-butyl (10bR)-7-chloro-6-oxo-9-(trifluoromethylsulfonyloxy)-1,3,4,10b-tetrahydropyrazino[2,1-a]isoindole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN2C(=O)c3c(Cl)cc(OS(=O)(=O)C(F)(F)F)cc3[C@@H]2C1 |
| InChI | InChI=1S/C17H18ClF3N2O6S/c1-16(2,3)28-15(25)22-4-5-23-12(8-22)10-6-9(7-11(18)13(10)14(23)24)29-30(26,27)17(19,20)21/h6-7,12H,4-5,8H2,1-3H3/t12-/m0/s1 |
| InChIKey | MIBPNUYQUKLQAI-LBPRGKRZSA-N |
| XLogP | 3.32 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.85 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|