C16H21F3N2O5S — CID 121271041
tert-butyl 3-[6-methyl-4-(trifluoromethylsulfonyloxy)-2-pyridinyl]pyrrolidine-1-carboxylate (PubChem CID 121271041) has the molecular formula C16H21F3N2O5S and a molecular weight of 410.41 g/mol. Its IUPAC name is tert-butyl 3-[6-methyl-4-(trifluoromethylsulfonyloxy)-2-pyridinyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 3-[6-methyl-4-(trifluoromethylsulfonyloxy)-2-pyridinyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 121271041 |
| Molecular Formula | C16H21F3N2O5S |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | tert-butyl 3-[6-methyl-4-(trifluoromethylsulfonyloxy)-2-pyridinyl]pyrrolidine-1-carboxylate |
| SMILES | Cc1cc(OS(=O)(=O)C(F)(F)F)cc(C2CCN(C(=O)OC(C)(C)C)C2)n1 |
| InChI | InChI=1S/C16H21F3N2O5S/c1-10-7-12(26-27(23,24)16(17,18)19)8-13(20-10)11-5-6-21(9-11)14(22)25-15(2,3)4/h7-8,11H,5-6,9H2,1-4H3 |
| InChIKey | VRZZTEQQYSZMLI-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 85.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|