C14H20F3N3O5S — CID 23531038
tert-butyl 4-[3-(trifluoromethylsulfonyloxy)-1H-pyrazol-5-yl]piperidine-1-carboxylate (PubChem CID 23531038) has the molecular formula C14H20F3N3O5S and a molecular weight of 399.39 g/mol. Its IUPAC name is tert-butyl 4-[3-(trifluoromethylsulfonyloxy)-1H-pyrazol-5-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-(trifluoromethylsulfonyloxy)-1H-pyrazol-5-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 23531038 |
| Molecular Formula | C14H20F3N3O5S |
| Molecular Weight | 399.39 g/mol |
| Exact Mass | 399.11 |
| IUPAC Name | tert-butyl 4-[3-(trifluoromethylsulfonyloxy)-1H-pyrazol-5-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2cc(OS(=O)(=O)C(F)(F)F)n[nH]2)CC1 |
| InChI | InChI=1S/C14H20F3N3O5S/c1-13(2,3)24-12(21)20-6-4-9(5-7-20)10-8-11(19-18-10)25-26(22,23)14(15,16)17/h8-9H,4-7H2,1-3H3,(H,18,19) |
| InChIKey | WYTGCUIJHCSVIA-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 101.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.39 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|