C21H33ClN4O3 — CID 146098685
tert-butyl 4-[3-[1-(2-chloropropanoyl)piperidin-4-yl]-1H-pyrazol-5-yl]piperidine-1-carboxylate (PubChem CID 146098685) has the molecular formula C21H33ClN4O3 and a molecular weight of 424.97 g/mol. Its IUPAC name is tert-butyl 4-[3-[1-(2-chloropropanoyl)piperidin-4-yl]-1H-pyrazol-5-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[1-(2-chloropropanoyl)piperidin-4-yl]-1H-pyrazol-5-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 146098685 |
| Molecular Formula | C21H33ClN4O3 |
| Molecular Weight | 424.97 g/mol |
| Exact Mass | 424.22 |
| IUPAC Name | tert-butyl 4-[3-[1-(2-chloropropanoyl)piperidin-4-yl]-1H-pyrazol-5-yl]piperidine-1-carboxylate |
| SMILES | CC(Cl)C(=O)N1CCC(c2cc(C3CCN(C(=O)OC(C)(C)C)CC3)[nH]n2)CC1 |
| InChI | InChI=1S/C21H33ClN4O3/c1-14(22)19(27)25-9-5-15(6-10-25)17-13-18(24-23-17)16-7-11-26(12-8-16)20(28)29-21(2,3)4/h13-16H,5-12H2,1-4H3,(H,23,24) |
| InChIKey | SZRLCZSXQJCGTF-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.97 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|