C15H22ClN3O2 — CID 95970009
tert-butyl (3R)-3-(6-chloro-2-methylpyrimidin-4-yl)piperidine-1-carboxylate (PubChem CID 95970009) has the molecular formula C15H22ClN3O2 and a molecular weight of 311.81 g/mol. Its IUPAC name is tert-butyl (3R)-3-(6-chloro-2-methylpyrimidin-4-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-(6-chloro-2-methylpyrimidin-4-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 95970009 |
| Molecular Formula | C15H22ClN3O2 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | tert-butyl (3R)-3-(6-chloro-2-methylpyrimidin-4-yl)piperidine-1-carboxylate |
| SMILES | Cc1nc(Cl)cc([C@@H]2CCCN(C(=O)OC(C)(C)C)C2)n1 |
| InChI | InChI=1S/C15H22ClN3O2/c1-10-17-12(8-13(16)18-10)11-6-5-7-19(9-11)14(20)21-15(2,3)4/h8,11H,5-7,9H2,1-4H3/t11-/m1/s1 |
| InChIKey | HTZUAHFWQVAMPM-LLVKDONJSA-N |
| XLogP | 3.55 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |