C22H24F6N4O8S2 — CID 23160590
tert-butyl 3-[2-amino-6-[2,6-bis(trifluoromethylsulfonyloxy)phenyl]pyrimidin-4-yl]piperidine-1-carboxylate (PubChem CID 23160590) has the molecular formula C22H24F6N4O8S2 and a molecular weight of 650.58 g/mol. Its IUPAC name is tert-butyl 3-[2-amino-6-[2,6-bis(trifluoromethylsulfonyloxy)phenyl]pyrimidin-4-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-amino-6-[2,6-bis(trifluoromethylsulfonyloxy)phenyl]pyrimidin-4-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 23160590 |
| Molecular Formula | C22H24F6N4O8S2 |
| Molecular Weight | 650.58 g/mol |
| Exact Mass | 650.09 |
| IUPAC Name | tert-butyl 3-[2-amino-6-[2,6-bis(trifluoromethylsulfonyloxy)phenyl]pyrimidin-4-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(c2cc(-c3c(OS(=O)(=O)C(F)(F)F)cccc3OS(=O)(=O)C(F)(F)F)nc(N)n2)C1 |
| InChI | InChI=1S/C22H24F6N4O8S2/c1-20(2,3)38-19(33)32-9-5-6-12(11-32)13-10-14(31-18(29)30-13)17-15(39-41(34,35)21(23,24)25)7-4-8-16(17)40-42(36,37)22(26,27)28/h4,7-8,10,12H,5-6,9,11H2,1-3H3,(H2,29,30,31) |
| InChIKey | LQTMPCZDUGCJSP-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 168.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.58 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|