C23H30N4O4 — CID 135618265
tert-butyl 3-[2-amino-6-(2-hydroxy-6-prop-2-enoxyphenyl)pyrimidin-4-yl]piperidine-1-carboxylate (PubChem CID 135618265) has the molecular formula C23H30N4O4 and a molecular weight of 426.52 g/mol. Its IUPAC name is tert-butyl 3-[2-amino-6-(2-hydroxy-6-prop-2-enoxyphenyl)pyrimidin-4-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[2-amino-6-(2-hydroxy-6-prop-2-enoxyphenyl)pyrimidin-4-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 135618265 |
| Molecular Formula | C23H30N4O4 |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.23 |
| IUPAC Name | tert-butyl 3-[2-amino-6-(2-hydroxy-6-prop-2-enoxyphenyl)pyrimidin-4-yl]piperidine-1-carboxylate |
| SMILES | C=CCOc1cccc(O)c1-c1cc(C2CCCN(C(=O)OC(C)(C)C)C2)nc(N)n1 |
| InChI | InChI=1S/C23H30N4O4/c1-5-12-30-19-10-6-9-18(28)20(19)17-13-16(25-21(24)26-17)15-8-7-11-27(14-15)22(29)31-23(2,3)4/h5-6,9-10,13,15,28H,1,7-8,11-12,14H2,2-4H3,(H2,24,25,26) |
| InChIKey | HGRZLTIHJNPIMA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|