C18H26F3NO6S — CID 145004659
tert-butyl 6-methyl-8-(trifluoromethylsulfonyloxy)-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate;ethane (PubChem CID 145004659) has the molecular formula C18H26F3NO6S and a molecular weight of 441.47 g/mol. Its IUPAC name is tert-butyl 6-methyl-8-(trifluoromethylsulfonyloxy)-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate;ethane.
| Compound Name | tert-butyl 6-methyl-8-(trifluoromethylsulfonyloxy)-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate;ethane |
|---|---|
| PubChem CID | 145004659 |
| Molecular Formula | C18H26F3NO6S |
| Molecular Weight | 441.47 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | tert-butyl 6-methyl-8-(trifluoromethylsulfonyloxy)-3,5-dihydro-2H-1,4-benzoxazepine-4-carboxylate;ethane |
| SMILES | CC.Cc1cc(OS(=O)(=O)C(F)(F)F)cc2c1CN(C(=O)OC(C)(C)C)CCO2 |
| InChI | InChI=1S/C16H20F3NO6S.C2H6/c1-10-7-11(26-27(22,23)16(17,18)19)8-13-12(10)9-20(5-6-24-13)14(21)25-15(2,3)4;1-2/h7-8H,5-6,9H2,1-4H3;1-2H3 |
| InChIKey | LZRLGYXZCADENJ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.47 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|