C25H31NO5 — CID 155992414
15-[(2-methylpropan-2-yl)oxycarbonyl]-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxylic acid (PubChem CID 155992414) has the molecular formula C25H31NO5 and a molecular weight of 425.53 g/mol. Its IUPAC name is 15-[(2-methylpropan-2-yl)oxycarbonyl]-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxylic acid.
| Compound Name | 15-[(2-methylpropan-2-yl)oxycarbonyl]-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxylic acid |
|---|---|
| PubChem CID | 155992414 |
| Molecular Formula | C25H31NO5 |
| Molecular Weight | 425.53 g/mol |
| Exact Mass | 425.22 |
| IUPAC Name | 15-[(2-methylpropan-2-yl)oxycarbonyl]-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)N1CCCCCOc2ccc(C(=O)O)cc2Cc2cccc(c2)C1 |
| InChI | InChI=1S/C25H31NO5/c1-25(2,3)31-24(29)26-12-5-4-6-13-30-22-11-10-20(23(27)28)16-21(22)15-18-8-7-9-19(14-18)17-26/h7-11,14,16H,4-6,12-13,15,17H2,1-3H3,(H,27,28) |
| InChIKey | GCTKEZHKCHDBFN-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.53 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |