C26H34N2O4 — CID 110072755
2-[(15-propyl-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carbonyl)amino]propanoic acid (PubChem CID 110072755) has the molecular formula C26H34N2O4 and a molecular weight of 438.57 g/mol. Its IUPAC name is 2-[(15-propyl-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carbonyl)amino]propanoic acid.
| Compound Name | 2-[(15-propyl-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 110072755 |
| Molecular Formula | C26H34N2O4 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | 2-[(15-propyl-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carbonyl)amino]propanoic acid |
| SMILES | CCCN1CCCCCOc2ccc(C(=O)NC(C)C(=O)O)cc2Cc2cccc(c2)C1 |
| InChI | InChI=1S/C26H34N2O4/c1-3-12-28-13-5-4-6-14-32-24-11-10-22(25(29)27-19(2)26(30)31)17-23(24)16-20-8-7-9-21(15-20)18-28/h7-11,15,17,19H,3-6,12-14,16,18H2,1-2H3,(H,27,29)(H,30,31) |
| InChIKey | RDRKRYHAOZJGIW-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |