C30H41N3O2 — CID 110072536
15-(cyclopropylmethyl)-N-(2-pyrrolidin-1-ylethyl)-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide (PubChem CID 110072536) has the molecular formula C30H41N3O2 and a molecular weight of 475.68 g/mol. Its IUPAC name is 15-(cyclopropylmethyl)-N-(2-pyrrolidin-1-ylethyl)-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide.
| Compound Name | 15-(cyclopropylmethyl)-N-(2-pyrrolidin-1-ylethyl)-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide |
|---|---|
| PubChem CID | 110072536 |
| Molecular Formula | C30H41N3O2 |
| Molecular Weight | 475.68 g/mol |
| Exact Mass | 475.32 |
| IUPAC Name | 15-(cyclopropylmethyl)-N-(2-pyrrolidin-1-ylethyl)-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide |
| SMILES | O=C(NCCN1CCCC1)c1ccc2c(c1)Cc1cccc(c1)CN(CC1CC1)CCCCCO2 |
| InChI | InChI=1S/C30H41N3O2/c34-30(31-13-17-32-14-3-4-15-32)27-11-12-29-28(21-27)20-25-7-6-8-26(19-25)23-33(22-24-9-10-24)16-2-1-5-18-35-29/h6-8,11-12,19,21,24H,1-5,9-10,13-18,20,22-23H2,(H,31,34) |
| InChIKey | IPNAIUQEORRKCF-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.68 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |