C29H38N2O4 — CID 110072729
2-[[15-(cyclopropylmethyl)-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carbonyl]amino]-3-methylbutanoic acid (PubChem CID 110072729) has the molecular formula C29H38N2O4 and a molecular weight of 478.63 g/mol. Its IUPAC name is 2-[[15-(cyclopropylmethyl)-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carbonyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[15-(cyclopropylmethyl)-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carbonyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 110072729 |
| Molecular Formula | C29H38N2O4 |
| Molecular Weight | 478.63 g/mol |
| Exact Mass | 478.28 |
| IUPAC Name | 2-[[15-(cyclopropylmethyl)-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carbonyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)C(NC(=O)c1ccc2c(c1)Cc1cccc(c1)CN(CC1CC1)CCCCCO2)C(=O)O |
| InChI | InChI=1S/C29H38N2O4/c1-20(2)27(29(33)34)30-28(32)24-11-12-26-25(17-24)16-22-7-6-8-23(15-22)19-31(18-21-9-10-21)13-4-3-5-14-35-26/h6-8,11-12,15,17,20-21,27H,3-5,9-10,13-14,16,18-19H2,1-2H3,(H,30,32)(H,33,34) |
| InChIKey | RLRAVMUQTNUSKI-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.63 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |