C24H30N2O4 — CID 110072742
2-[(15-methyl-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carbonyl)amino]propanoic acid (PubChem CID 110072742) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is 2-[(15-methyl-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carbonyl)amino]propanoic acid.
| Compound Name | 2-[(15-methyl-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 110072742 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 2-[(15-methyl-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carbonyl)amino]propanoic acid |
| SMILES | CC(NC(=O)c1ccc2c(c1)Cc1cccc(c1)CN(C)CCCCCO2)C(=O)O |
| InChI | InChI=1S/C24H30N2O4/c1-17(24(28)29)25-23(27)20-9-10-22-21(15-20)14-18-7-6-8-19(13-18)16-26(2)11-4-3-5-12-30-22/h6-10,13,15,17H,3-5,11-12,14,16H2,1-2H3,(H,25,27)(H,28,29) |
| InChIKey | WGVNJXCOYLBVHM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |