C33H41N3O3 — CID 110072901
15-methyl-N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide (PubChem CID 110072901) has the molecular formula C33H41N3O3 and a molecular weight of 527.71 g/mol. Its IUPAC name is 15-methyl-N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide.
| Compound Name | 15-methyl-N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide |
|---|---|
| PubChem CID | 110072901 |
| Molecular Formula | C33H41N3O3 |
| Molecular Weight | 527.71 g/mol |
| Exact Mass | 527.31 |
| IUPAC Name | 15-methyl-N-[[3-(morpholin-4-ylmethyl)phenyl]methyl]-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide |
| SMILES | CN1CCCCCOc2ccc(C(=O)NCc3cccc(CN4CCOCC4)c3)cc2Cc2cccc(c2)C1 |
| InChI | InChI=1S/C33H41N3O3/c1-35-13-3-2-4-16-39-32-12-11-30(22-31(32)21-26-7-5-9-28(19-26)24-35)33(37)34-23-27-8-6-10-29(20-27)25-36-14-17-38-18-15-36/h5-12,19-20,22H,2-4,13-18,21,23-25H2,1H3,(H,34,37) |
| InChIKey | GXFIOOMIZYAARR-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.71 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |