C29H34N2O3 — CID 110072916
N-[(2-methoxyphenyl)methyl]-15-methyl-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide (PubChem CID 110072916) has the molecular formula C29H34N2O3 and a molecular weight of 458.60 g/mol. Its IUPAC name is N-[(2-methoxyphenyl)methyl]-15-methyl-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide.
| Compound Name | N-[(2-methoxyphenyl)methyl]-15-methyl-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide |
|---|---|
| PubChem CID | 110072916 |
| Molecular Formula | C29H34N2O3 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | N-[(2-methoxyphenyl)methyl]-15-methyl-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide |
| SMILES | COc1ccccc1CNC(=O)c1ccc2c(c1)Cc1cccc(c1)CN(C)CCCCCO2 |
| InChI | InChI=1S/C29H34N2O3/c1-31-15-6-3-7-16-34-28-14-13-24(19-26(28)18-22-9-8-10-23(17-22)21-31)29(32)30-20-25-11-4-5-12-27(25)33-2/h4-5,8-14,17,19H,3,6-7,15-16,18,20-21H2,1-2H3,(H,30,32) |
| InChIKey | ICDPKSLLCOVOBH-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |