C36H46N2O5 — CID 110072976
N-[(4-methoxy-2-methyl-5-propan-2-ylphenyl)methyl]-15-(oxan-4-yl)-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide (PubChem CID 110072976) has the molecular formula C36H46N2O5 and a molecular weight of 586.77 g/mol. Its IUPAC name is N-[(4-methoxy-2-methyl-5-propan-2-ylphenyl)methyl]-15-(oxan-4-yl)-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide.
| Compound Name | N-[(4-methoxy-2-methyl-5-propan-2-ylphenyl)methyl]-15-(oxan-4-yl)-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide |
|---|---|
| PubChem CID | 110072976 |
| Molecular Formula | C36H46N2O5 |
| Molecular Weight | 586.77 g/mol |
| Exact Mass | 586.34 |
| IUPAC Name | N-[(4-methoxy-2-methyl-5-propan-2-ylphenyl)methyl]-15-(oxan-4-yl)-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide |
| SMILES | COc1cc(C)c(CNC(=O)c2ccc3c(c2)Cc2cccc(c2)CN(C2CCOCC2)CCOCCO3)cc1C(C)C |
| InChI | InChI=1S/C36H46N2O5/c1-25(2)33-22-31(26(3)18-35(33)40-4)23-37-36(39)29-8-9-34-30(21-29)20-27-6-5-7-28(19-27)24-38(12-15-42-16-17-43-34)32-10-13-41-14-11-32/h5-9,18-19,21-22,25,32H,10-17,20,23-24H2,1-4H3,(H,37,39) |
| InChIKey | OCWLZWIMLNBJHA-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.77 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |