C33H37ClN2O6 — CID 110072808
2-[(2-chlorophenyl)methyl-[15-(oxan-4-yl)-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carbonyl]amino]acetic acid (PubChem CID 110072808) has the molecular formula C33H37ClN2O6 and a molecular weight of 593.12 g/mol. Its IUPAC name is 2-[(2-chlorophenyl)methyl-[15-(oxan-4-yl)-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carbonyl]amino]acetic acid.
| Compound Name | 2-[(2-chlorophenyl)methyl-[15-(oxan-4-yl)-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carbonyl]amino]acetic acid |
|---|---|
| PubChem CID | 110072808 |
| Molecular Formula | C33H37ClN2O6 |
| Molecular Weight | 593.12 g/mol |
| Exact Mass | 592.23 |
| IUPAC Name | 2-[(2-chlorophenyl)methyl-[15-(oxan-4-yl)-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carbonyl]amino]acetic acid |
| SMILES | O=C(O)CN(Cc1ccccc1Cl)C(=O)c1ccc2c(c1)Cc1cccc(c1)CN(C1CCOCC1)CCOCCO2 |
| InChI | InChI=1S/C33H37ClN2O6/c34-30-7-2-1-6-27(30)22-36(23-32(37)38)33(39)26-8-9-31-28(20-26)19-24-4-3-5-25(18-24)21-35(12-15-41-16-17-42-31)29-10-13-40-14-11-29/h1-9,18,20,29H,10-17,19,21-23H2,(H,37,38) |
| InChIKey | JUZZDSIFORBUSH-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.12 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |