C27H34N2O3 — CID 110072655
(15-cyclobutyl-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-5-yl)-(3-hydroxyazetidin-1-yl)methanone (PubChem CID 110072655) has the molecular formula C27H34N2O3 and a molecular weight of 434.58 g/mol. Its IUPAC name is (15-cyclobutyl-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-5-yl)-(3-hydroxyazetidin-1-yl)methanone.
| Compound Name | (15-cyclobutyl-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-5-yl)-(3-hydroxyazetidin-1-yl)methanone |
|---|---|
| PubChem CID | 110072655 |
| Molecular Formula | C27H34N2O3 |
| Molecular Weight | 434.58 g/mol |
| Exact Mass | 434.26 |
| IUPAC Name | (15-cyclobutyl-9-oxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-5-yl)-(3-hydroxyazetidin-1-yl)methanone |
| SMILES | O=C(c1ccc2c(c1)Cc1cccc(c1)CN(C1CCC1)CCCCCO2)N1CC(O)C1 |
| InChI | InChI=1S/C27H34N2O3/c30-25-18-29(19-25)27(31)22-10-11-26-23(16-22)15-20-6-4-7-21(14-20)17-28(24-8-5-9-24)12-2-1-3-13-32-26/h4,6-7,10-11,14,16,24-25,30H,1-3,5,8-9,12-13,15,17-19H2 |
| InChIKey | ZANFGTBQJDMLMW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.58 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |