C28H38N2O4 — CID 110072850
(4-hydroxypiperidin-1-yl)-[15-(2-methylpropyl)-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-5-yl]methanone (PubChem CID 110072850) has the molecular formula C28H38N2O4 and a molecular weight of 466.62 g/mol. Its IUPAC name is (4-hydroxypiperidin-1-yl)-[15-(2-methylpropyl)-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-5-yl]methanone.
| Compound Name | (4-hydroxypiperidin-1-yl)-[15-(2-methylpropyl)-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-5-yl]methanone |
|---|---|
| PubChem CID | 110072850 |
| Molecular Formula | C28H38N2O4 |
| Molecular Weight | 466.62 g/mol |
| Exact Mass | 466.28 |
| IUPAC Name | (4-hydroxypiperidin-1-yl)-[15-(2-methylpropyl)-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-5-yl]methanone |
| SMILES | CC(C)CN1CCOCCOc2ccc(C(=O)N3CCC(O)CC3)cc2Cc2cccc(c2)C1 |
| InChI | InChI=1S/C28H38N2O4/c1-21(2)19-29-12-13-33-14-15-34-27-7-6-24(28(32)30-10-8-26(31)9-11-30)18-25(27)17-22-4-3-5-23(16-22)20-29/h3-7,16,18,21,26,31H,8-15,17,19-20H2,1-2H3 |
| InChIKey | IQBGFDQOPLLMDC-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.62 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |