C30H42N2O4 — CID 110072862
[4-(2-hydroxyethyl)piperidin-1-yl]-[15-(2-methylpropyl)-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-5-yl]methanone (PubChem CID 110072862) has the molecular formula C30H42N2O4 and a molecular weight of 494.68 g/mol. Its IUPAC name is [4-(2-hydroxyethyl)piperidin-1-yl]-[15-(2-methylpropyl)-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-5-yl]methanone.
| Compound Name | [4-(2-hydroxyethyl)piperidin-1-yl]-[15-(2-methylpropyl)-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-5-yl]methanone |
|---|---|
| PubChem CID | 110072862 |
| Molecular Formula | C30H42N2O4 |
| Molecular Weight | 494.68 g/mol |
| Exact Mass | 494.31 |
| IUPAC Name | [4-(2-hydroxyethyl)piperidin-1-yl]-[15-(2-methylpropyl)-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-5-yl]methanone |
| SMILES | CC(C)CN1CCOCCOc2ccc(C(=O)N3CCC(CCO)CC3)cc2Cc2cccc(c2)C1 |
| InChI | InChI=1S/C30H42N2O4/c1-23(2)21-31-13-15-35-16-17-36-29-7-6-27(30(34)32-11-8-24(9-12-32)10-14-33)20-28(29)19-25-4-3-5-26(18-25)22-31/h3-7,18,20,23-24,33H,8-17,19,21-22H2,1-2H3 |
| InChIKey | QCDQGSSMHQGBTH-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 62.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.68 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |