C28H39N3O3 — CID 110072682
(4-methyl-1,4-diazepan-1-yl)-(15-propan-2-yl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-5-yl)methanone (PubChem CID 110072682) has the molecular formula C28H39N3O3 and a molecular weight of 465.64 g/mol. Its IUPAC name is (4-methyl-1,4-diazepan-1-yl)-(15-propan-2-yl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-5-yl)methanone.
| Compound Name | (4-methyl-1,4-diazepan-1-yl)-(15-propan-2-yl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-5-yl)methanone |
|---|---|
| PubChem CID | 110072682 |
| Molecular Formula | C28H39N3O3 |
| Molecular Weight | 465.64 g/mol |
| Exact Mass | 465.30 |
| IUPAC Name | (4-methyl-1,4-diazepan-1-yl)-(15-propan-2-yl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-5-yl)methanone |
| SMILES | CC(C)N1CCOCCOc2ccc(C(=O)N3CCCN(C)CC3)cc2Cc2cccc(c2)C1 |
| InChI | InChI=1S/C28H39N3O3/c1-22(2)31-14-15-33-16-17-34-27-9-8-25(28(32)30-11-5-10-29(3)12-13-30)20-26(27)19-23-6-4-7-24(18-23)21-31/h4,6-9,18,20,22H,5,10-17,19,21H2,1-3H3 |
| InChIKey | PDVMVODFKVVNOK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.64 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |