C30H36N2O4 — CID 110072701
N-[(1S)-2-hydroxy-1-phenylethyl]-15-propan-2-yl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide (PubChem CID 110072701) has the molecular formula C30H36N2O4 and a molecular weight of 488.63 g/mol. Its IUPAC name is N-[(1S)-2-hydroxy-1-phenylethyl]-15-propan-2-yl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide.
| Compound Name | N-[(1S)-2-hydroxy-1-phenylethyl]-15-propan-2-yl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide |
|---|---|
| PubChem CID | 110072701 |
| Molecular Formula | C30H36N2O4 |
| Molecular Weight | 488.63 g/mol |
| Exact Mass | 488.27 |
| IUPAC Name | N-[(1S)-2-hydroxy-1-phenylethyl]-15-propan-2-yl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide |
| SMILES | CC(C)N1CCOCCOc2ccc(C(=O)N[C@H](CO)c3ccccc3)cc2Cc2cccc(c2)C1 |
| InChI | InChI=1S/C30H36N2O4/c1-22(2)32-13-14-35-15-16-36-29-12-11-26(19-27(29)18-23-7-6-8-24(17-23)20-32)30(34)31-28(21-33)25-9-4-3-5-10-25/h3-12,17,19,22,28,33H,13-16,18,20-21H2,1-2H3,(H,31,34)/t28-/m1/s1 |
| InChIKey | OIJOPYLYORHAEL-MUUNZHRXSA-N |
| XLogP | 4.36 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.63 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |