C34H37N3O4 — CID 110072602
N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-15-(pyridin-2-ylmethyl)-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide (PubChem CID 110072602) has the molecular formula C34H37N3O4 and a molecular weight of 551.69 g/mol. Its IUPAC name is N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-15-(pyridin-2-ylmethyl)-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide.
| Compound Name | N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-15-(pyridin-2-ylmethyl)-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide |
|---|---|
| PubChem CID | 110072602 |
| Molecular Formula | C34H37N3O4 |
| Molecular Weight | 551.69 g/mol |
| Exact Mass | 551.28 |
| IUPAC Name | N-[(2S)-1-hydroxy-3-phenylpropan-2-yl]-15-(pyridin-2-ylmethyl)-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide |
| SMILES | O=C(N[C@H](CO)Cc1ccccc1)c1ccc2c(c1)Cc1cccc(c1)CN(Cc1ccccn1)CCOCCO2 |
| InChI | InChI=1S/C34H37N3O4/c38-25-32(21-26-7-2-1-3-8-26)36-34(39)29-12-13-33-30(22-29)20-27-9-6-10-28(19-27)23-37(15-16-40-17-18-41-33)24-31-11-4-5-14-35-31/h1-14,19,22,32,38H,15-18,20-21,23-25H2,(H,36,39)/t32-/m0/s1 |
| InChIKey | YJBCSVSESNMFFB-YTTGMZPUSA-N |
| XLogP | 4.42 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.69 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |