C32H32ClN3O3 — CID 110072969
N-[(4-chlorophenyl)methyl]-15-(pyridin-2-ylmethyl)-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide (PubChem CID 110072969) has the molecular formula C32H32ClN3O3 and a molecular weight of 542.08 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-15-(pyridin-2-ylmethyl)-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-15-(pyridin-2-ylmethyl)-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide |
|---|---|
| PubChem CID | 110072969 |
| Molecular Formula | C32H32ClN3O3 |
| Molecular Weight | 542.08 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-15-(pyridin-2-ylmethyl)-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxamide |
| SMILES | O=C(NCc1ccc(Cl)cc1)c1ccc2c(c1)Cc1cccc(c1)CN(Cc1ccccn1)CCOCCO2 |
| InChI | InChI=1S/C32H32ClN3O3/c33-29-10-7-24(8-11-29)21-35-32(37)27-9-12-31-28(20-27)19-25-4-3-5-26(18-25)22-36(14-15-38-16-17-39-31)23-30-6-1-2-13-34-30/h1-13,18,20H,14-17,19,21-23H2,(H,35,37) |
| InChIKey | OWMRSPACKWHAQN-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.08 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |