C26H25F2NO4 — CID 155994854
15-[(3,4-difluorophenyl)methyl]-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxylic acid (PubChem CID 155994854) has the molecular formula C26H25F2NO4 and a molecular weight of 453.49 g/mol. Its IUPAC name is 15-[(3,4-difluorophenyl)methyl]-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxylic acid.
| Compound Name | 15-[(3,4-difluorophenyl)methyl]-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxylic acid |
|---|---|
| PubChem CID | 155994854 |
| Molecular Formula | C26H25F2NO4 |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | 15-[(3,4-difluorophenyl)methyl]-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(c1)Cc1cccc(c1)CN(Cc1ccc(F)c(F)c1)CCOCCO2 |
| InChI | InChI=1S/C26H25F2NO4/c27-23-6-4-20(14-24(23)28)17-29-8-9-32-10-11-33-25-7-5-21(26(30)31)15-22(25)13-18-2-1-3-19(12-18)16-29/h1-7,12,14-15H,8-11,13,16-17H2,(H,30,31) |
| InChIKey | GCNLWWJOANKLOR-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |