C27H29NO6 — CID 133079035
15-[(2-hydroxy-5-methoxyphenyl)methyl]-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxylic acid (PubChem CID 133079035) has the molecular formula C27H29NO6 and a molecular weight of 463.53 g/mol. Its IUPAC name is 15-[(2-hydroxy-5-methoxyphenyl)methyl]-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxylic acid.
| Compound Name | 15-[(2-hydroxy-5-methoxyphenyl)methyl]-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxylic acid |
|---|---|
| PubChem CID | 133079035 |
| Molecular Formula | C27H29NO6 |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | 15-[(2-hydroxy-5-methoxyphenyl)methyl]-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaene-5-carboxylic acid |
| SMILES | COc1ccc(O)c(CN2CCOCCOc3ccc(C(=O)O)cc3Cc3cccc(c3)C2)c1 |
| InChI | InChI=1S/C27H29NO6/c1-32-24-6-7-25(29)23(16-24)18-28-9-10-33-11-12-34-26-8-5-21(27(30)31)15-22(26)14-19-3-2-4-20(13-19)17-28/h2-8,13,15-16,29H,9-12,14,17-18H2,1H3,(H,30,31) |
| InChIKey | ARRMYMXRXSERLC-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|