C28H31NO4 — CID 110068390
2-(4-methoxyphenyl)-1-(5-methyl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-15-yl)ethanone (PubChem CID 110068390) has the molecular formula C28H31NO4 and a molecular weight of 445.56 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-1-(5-methyl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-15-yl)ethanone.
| Compound Name | 2-(4-methoxyphenyl)-1-(5-methyl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-15-yl)ethanone |
|---|---|
| PubChem CID | 110068390 |
| Molecular Formula | C28H31NO4 |
| Molecular Weight | 445.56 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | 2-(4-methoxyphenyl)-1-(5-methyl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-15-yl)ethanone |
| SMILES | COc1ccc(CC(=O)N2CCOCCOc3ccc(C)cc3Cc3cccc(c3)C2)cc1 |
| InChI | InChI=1S/C28H31NO4/c1-21-6-11-27-25(16-21)18-23-4-3-5-24(17-23)20-29(12-13-32-14-15-33-27)28(30)19-22-7-9-26(31-2)10-8-22/h3-11,16-17H,12-15,18-20H2,1-2H3 |
| InChIKey | WEZMYFXRLUTVOO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.56 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |