C29H33NO3 — CID 110069146
1-(5-ethyl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-15-yl)-2-(3-methylphenyl)ethanone (PubChem CID 110069146) has the molecular formula C29H33NO3 and a molecular weight of 443.59 g/mol. Its IUPAC name is 1-(5-ethyl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-15-yl)-2-(3-methylphenyl)ethanone.
| Compound Name | 1-(5-ethyl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-15-yl)-2-(3-methylphenyl)ethanone |
|---|---|
| PubChem CID | 110069146 |
| Molecular Formula | C29H33NO3 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.25 |
| IUPAC Name | 1-(5-ethyl-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-15-yl)-2-(3-methylphenyl)ethanone |
| SMILES | CCc1ccc2c(c1)Cc1cccc(c1)CN(C(=O)Cc1cccc(C)c1)CCOCCO2 |
| InChI | InChI=1S/C29H33NO3/c1-3-23-10-11-28-27(18-23)19-25-8-5-9-26(17-25)21-30(12-13-32-14-15-33-28)29(31)20-24-7-4-6-22(2)16-24/h4-11,16-18H,3,12-15,19-21H2,1-2H3 |
| InChIKey | BFVWHUIWIXDMQK-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |