C27H36FN3O3 — CID 155994331
1-(5-fluoro-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-15-yl)-2-(4-propan-2-ylpiperazin-1-yl)ethanone (PubChem CID 155994331) has the molecular formula C27H36FN3O3 and a molecular weight of 469.60 g/mol. Its IUPAC name is 1-(5-fluoro-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-15-yl)-2-(4-propan-2-ylpiperazin-1-yl)ethanone.
| Compound Name | 1-(5-fluoro-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-15-yl)-2-(4-propan-2-ylpiperazin-1-yl)ethanone |
|---|---|
| PubChem CID | 155994331 |
| Molecular Formula | C27H36FN3O3 |
| Molecular Weight | 469.60 g/mol |
| Exact Mass | 469.27 |
| IUPAC Name | 1-(5-fluoro-9,12-dioxa-15-azatricyclo[15.3.1.03,8]henicosa-1(21),3(8),4,6,17,19-hexaen-15-yl)-2-(4-propan-2-ylpiperazin-1-yl)ethanone |
| SMILES | CC(C)N1CCN(CC(=O)N2CCOCCOc3ccc(F)cc3Cc3cccc(c3)C2)CC1 |
| InChI | InChI=1S/C27H36FN3O3/c1-21(2)30-10-8-29(9-11-30)20-27(32)31-12-13-33-14-15-34-26-7-6-25(28)18-24(26)17-22-4-3-5-23(16-22)19-31/h3-7,16,18,21H,8-15,17,19-20H2,1-2H3 |
| InChIKey | LIHHPHJTFMJKCP-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.60 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |